CAS 1228182-71-5 is the registry number for 5-Bromo-2-oxo-6-phenyl-1,2-dihydropyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile (CAS 1228182-71-5) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 5-bromo-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile. InChIKey: IQIKVPXRHSWWJF-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2O |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 5-bromo-2-oxo-6-phenyl-1H-pyridine-3-carbonitrile |
| InChIKey | IQIKVPXRHSWWJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C(=O)N2)C#N)Br |
Computed by PubChem (NCBI)