CAS 938458-81-2 appears in our catalog under these names: 5-Bromo-2-pyridin-3-yl-1,3-benzoxazole, 95%, 5-Bromo-2-(pyridin-3-yl)benzo[d]oxazole, 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 250mg.
5-bromo-2-pyridin-3-yl-1,3-benzoxazole (CAS 938458-81-2) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 5-bromo-2-pyridin-3-yl-1,3-benzoxazole. InChIKey: XXVXIUHYSJGBIB-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2O |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 5-bromo-2-pyridin-3-yl-1,3-benzoxazole |
| InChIKey | XXVXIUHYSJGBIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)