CAS 890990-46-2 is the registry number for 2-(4-Bromophenyl)-[1,3]oxazolo[5,4-b]pyridine, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.
2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine (CAS 890990-46-2) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine. InChIKey: FKJPMLYDQRJPBK-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2O |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine |
| InChIKey | FKJPMLYDQRJPBK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)OC(=N2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)