Products 890990-46-2

CAS 890990-46-2 is the registry number for 2-(4-Bromophenyl)-[1,3]oxazolo[5,4-b]pyridine, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.

Structural formula: {0} (CAS {1})

2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine (CAS 890990-46-2) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine. InChIKey: FKJPMLYDQRJPBK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7BrN2O
Molecular weight275.10 g/mol
IUPAC name2-(4-bromophenyl)-[1,3]oxazolo[5,4-b]pyridine
InChIKeyFKJPMLYDQRJPBK-UHFFFAOYSA-N
SMILESC1=CC2=C(N=C1)OC(=N2)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)