CAS 111881-78-8 appears in our catalog under these names: 6-(4-Chlorophenyl)-4,6-dioxohexanoic acid, 95%, 6–(4–Chlorophenyl)–4,6–Dioxohexanoic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-(4-chlorophenyl)-4,6-dioxohexanoic acid (CAS 111881-78-8) is a chemical compound with the molecular formula C12H11ClO4 and a molecular weight of 254.66 g/mol. IUPAC name: 6-(4-chlorophenyl)-4,6-dioxohexanoic acid. InChIKey: PXNQAEKERWTPQO-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO4 |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-4,6-dioxohexanoic acid |
| InChIKey | PXNQAEKERWTPQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)