CAS 854357-33-8 appears in our catalog under these names: 3-(9-Chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid, 95%, (2E)-3-(9-Chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoic acid (CAS 854357-33-8) is a chemical compound with the molecular formula C12H11ClO4 and a molecular weight of 254.66 g/mol. IUPAC name: (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoic acid. InChIKey: HQPPUVMGHBRVRO-NSCUHMNNSA-N.
| Molecular formula | C12H11ClO4 |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoic acid |
| InChIKey | HQPPUVMGHBRVRO-NSCUHMNNSA-N |
| SMILES | C1COC2=C(C(=CC(=C2)/C=C/C(=O)O)Cl)OC1 |
Computed by PubChem (NCBI)