Products 5814-38-0
CAS 5814-38-0 appears in our catalog under these names: Ethyl 4–(4–chlorophenyl)–2，4–dioxobutanoate, Ethyl 4-(4-chlorophenyl)-2,4-dioxobutanoate, 98%. Offered by: GLPBio, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g, 50g.
Ethyl 4-(4-chlorophenyl)-2,4-dioxobutanoate (CAS 5814-38-0) is a chemical compound with the molecular formula C12H11ClO4 and a molecular weight of 254.66 g/mol. IUPAC name: ethyl 4-(4-chlorophenyl)-2,4-dioxobutanoate. InChIKey: BDFNRYGGOPNIAG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO4 |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | ethyl 4-(4-chlorophenyl)-2,4-dioxobutanoate |
| InChIKey | BDFNRYGGOPNIAG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 4-(4-chlorophenyl)-2,4-dioxobutanoate, Ethyl 4-chloro-a,g-dioxo-benzenebutanoate, Ethyl 4-(4-chlorophenyl)-2,4-dioxobutyrate, 2-Oxo-3-[3-chlorobenzoyl]propanoic acid, ethyl ester, Benzenebutanoic acid, 4-chloro-a,g-dioxo-, ethyl ester, benzenebutanoic acid, 4-chloro-alpha,gamma-dioxo-, ethyl ester, Ethyl 4-[4-chlorophenyl]-2,4-dioxobutyrate, 4-(4-chlorophenyl)-2,4-dioxo-butyric acid ethyl ester, Benzenebutanoic acid, 4-chloro-.alpha.,.gamma.-dioxo-, ethyl ester, ethyl 4-(4-chlorophenyl)-2,4-dioxo-butanoate