Products 55882-65-0
CAS 55882-65-0 is the registry number for (2E)-3-(4-(Acetyloxy)-3-methoxyphenyl)-2-propenoyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
[4-(3-chloro-3-oxoprop-1-enyl)-2-methoxyphenyl] acetate (CAS 55882-65-0) is a chemical compound with the molecular formula C12H11ClO4 and a molecular weight of 254.66 g/mol. IUPAC name: [4-(3-chloro-3-oxoprop-1-enyl)-2-methoxyphenyl] acetate. InChIKey: XGIHZUUVIHMRFM-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO4 |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | [4-(3-chloro-3-oxoprop-1-enyl)-2-methoxyphenyl] acetate |
| InChIKey | XGIHZUUVIHMRFM-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=CC(=O)Cl)OC |
Computed by PubChem (NCBI)