Products 338982-35-7
CAS 338982-35-7 appears in our catalog under these names: Ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate, 96%, Ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate, 95-<97%, Ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate, ≥97-<99%, Ethyl 4–(2–Chlorophenyl)–2，4–dioxobutanoate, Ethyl 4-(2-Chlorophenyl)-2,4-dioxobutanoate, >95%, >95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 50g, 100g, 200g, 300g.
Ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate (CAS 338982-35-7) is a chemical compound with the molecular formula C12H11ClO4 and a molecular weight of 254.66 g/mol. IUPAC name: ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate. InChIKey: CYWSDZSLUSCKMG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClO4 |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | ethyl 4-(2-chlorophenyl)-2,4-dioxobutanoate |
| InChIKey | CYWSDZSLUSCKMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)