CAS 111897-99-5 appears in our catalog under these names: (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-(o-tolyloxy)tetrahydro-2H-pyran-2-carboxylic acid, 97%, o-Cresol beta-D-Glucuronide, o-Cresol beta-D-Glucuronide, >95% (HPLC), o-Cresol-d7 beta-D-Glucuronide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
(3R,4R,5R,6R)-3,4,5-trihydroxy-6-(2-methylphenoxy)oxane-2-carboxylic acid (CAS 111897-99-5) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: (3R,4R,5R,6R)-3,4,5-trihydroxy-6-(2-methylphenoxy)oxane-2-carboxylic acid. InChIKey: UPSZSICMSBXXRN-YWNZWZMFSA-N.
| Molecular formula | C13H16O7 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | (3R,4R,5R,6R)-3,4,5-trihydroxy-6-(2-methylphenoxy)oxane-2-carboxylic acid |
| InChIKey | UPSZSICMSBXXRN-YWNZWZMFSA-N |
| SMILES | CC1=CC=CC=C1O[C@@H]2[C@@H]([C@@H]([C@H](C(O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)