Products 959852-02-9

CAS 959852-02-9 is the registry number for 5-(2-(2-Methoxyethoxy)ethoxy)isophthalic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-[2-(2-methoxyethoxy)ethoxy]benzene-1,3-dicarboxylic acid (CAS 959852-02-9) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: 5-[2-(2-methoxyethoxy)ethoxy]benzene-1,3-dicarboxylic acid. InChIKey: HRLVTWKVSKXZMD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O7
Molecular weight284.26 g/mol
IUPAC name5-[2-(2-methoxyethoxy)ethoxy]benzene-1,3-dicarboxylic acid
InChIKeyHRLVTWKVSKXZMD-UHFFFAOYSA-N
SMILESCOCCOCCOC1=CC(=CC(=C1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)