CAS 55811-42-2 appears in our catalog under these names: Phenyl b-D-Glucuronide Methyl Ester, Phenyl Beta-D-Glucuronide Methyl Ester. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
Methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylate (CAS 55811-42-2) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylate. InChIKey: CFQIPXDWJGLLGH-XPORZQOISA-N.
| Molecular formula | C13H16O7 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-phenoxyoxane-2-carboxylate |
| InChIKey | CFQIPXDWJGLLGH-XPORZQOISA-N |
| SMILES | COC(=O)[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC=CC=C2)O)O)O |
Computed by PubChem (NCBI)