CAS 14200-76-1 is the registry number for (2R,3R,4S,5R)-2,3,4,5-Tetrahydroxy-6-oxohexyl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] benzoate (CAS 14200-76-1) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] benzoate. InChIKey: VKUVHQLMDOUYND-IRCOFANPSA-N.
| Molecular formula | C13H16O7 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] benzoate |
| InChIKey | VKUVHQLMDOUYND-IRCOFANPSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O |
Computed by PubChem (NCBI)