CAS 90-75-5 is the registry number for ((2R,3S,4S,5R,6R)-3,4,5,6-Tetrahydroxytetrahydro-2H-pyran-2-yl)methyl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzoate (CAS 90-75-5) is a chemical compound with the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzoate. InChIKey: MRDRXKCKIMVUHN-BZNQNGANSA-N.
| Molecular formula | C13H16O7 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzoate |
| InChIKey | MRDRXKCKIMVUHN-BZNQNGANSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O)O |
Computed by PubChem (NCBI)