Products 1119207-53-2
CAS 1119207-53-2 is the registry number for 4-Chloro-6-(2-methylmorpholino)pyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-6-(2-methylmorpholin-4-yl)pyrimidin-2-amine (CAS 1119207-53-2) is a chemical compound with the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. IUPAC name: 4-chloro-6-(2-methylmorpholin-4-yl)pyrimidin-2-amine. InChIKey: OGOMOPQTDPXLTG-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O |
|---|---|
| Molecular weight | 228.68 g/mol |
| IUPAC name | 4-chloro-6-(2-methylmorpholin-4-yl)pyrimidin-2-amine |
| InChIKey | OGOMOPQTDPXLTG-UHFFFAOYSA-N |
| SMILES | CC1CN(CCO1)C2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)