Products 2089678-48-6
CAS 2089678-48-6 is the registry number for 2-Amino-1-(3-chloro-5,6-dihydroimidazo(1,2-a)pyrazin-7(8H)-yl)propan-1-one. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
2-amino-1-(3-chloro-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propan-1-one (CAS 2089678-48-6) is a chemical compound with the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. IUPAC name: 2-amino-1-(3-chloro-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propan-1-one. InChIKey: HAFMAPBPDQPWEB-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O |
|---|---|
| Molecular weight | 228.68 g/mol |
| IUPAC name | 2-amino-1-(3-chloro-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)propan-1-one |
| InChIKey | HAFMAPBPDQPWEB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCN2C(=NC=C2Cl)C1)N |
Computed by PubChem (NCBI)