Products 1494756-17-0
CAS 1494756-17-0 is the registry number for (1-(2-Amino-6-chloropyrimidin-4-yl)pyrrolidin-2-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methanol (CAS 1494756-17-0) is a chemical compound with the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. IUPAC name: [1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methanol. InChIKey: JZKRFJBGTJVVAE-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O |
|---|---|
| Molecular weight | 228.68 g/mol |
| IUPAC name | [1-(2-amino-6-chloropyrimidin-4-yl)pyrrolidin-2-yl]methanol |
| InChIKey | JZKRFJBGTJVVAE-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C2=CC(=NC(=N2)N)Cl)CO |
Computed by PubChem (NCBI)