CAS 1193388-32-7 is the registry number for 2-(3-Aminopropyl)-2H,3H-(1,2,4)triazolo(4,3-a)pyridin-3-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride (CAS 1193388-32-7) is a chemical compound with the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. IUPAC name: 2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride. InChIKey: DKPCAPPYTZMPQD-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O |
|---|---|
| Molecular weight | 228.68 g/mol |
| IUPAC name | 2-(3-aminopropyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one;hydrochloride |
| InChIKey | DKPCAPPYTZMPQD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN(C(=O)N2C=C1)CCCN.Cl |
Computed by PubChem (NCBI)