CAS 1432681-57-6 appears in our catalog under these names: 4-(3-Aminopyridin-2-yl)piperazin-2-one hydrochloride, 95%, 4-(3-Aminopyridin-2-yl)piperazin-2-one hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-(3-amino-2-pyridinyl)piperazin-2-one;hydrochloride (CAS 1432681-57-6) is a chemical compound with the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. IUPAC name: 4-(3-amino-2-pyridinyl)piperazin-2-one;hydrochloride. InChIKey: RBGCJDZADJOPJR-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN4O |
|---|---|
| Molecular weight | 228.68 g/mol |
| IUPAC name | 4-(3-amino-2-pyridinyl)piperazin-2-one;hydrochloride |
| InChIKey | RBGCJDZADJOPJR-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)C2=C(C=CC=N2)N.Cl |
Computed by PubChem (NCBI)