Products 111934-93-1

CAS 111934-93-1 is the registry number for 2,2-Dimethyl-1,3-dioxane-5,5-dicarboxylic Acid Dimethyl Ester. Offered by: TRC. Available pack sizes: 500mg, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate (CAS 111934-93-1) is a chemical compound with the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. IUPAC name: dimethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate. InChIKey: KUDIYQZLDUKKHX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O6
Molecular weight232.23 g/mol
IUPAC namedimethyl 2,2-dimethyl-1,3-dioxane-5,5-dicarboxylate
InChIKeyKUDIYQZLDUKKHX-UHFFFAOYSA-N
SMILESCC1(OCC(CO1)(C(=O)OC)C(=O)OC)C

Computed by PubChem (NCBI)