Products 855957-40-3

CAS 855957-40-3 is the registry number for Heptane-1,1,7-Tricarboxylic Acid Trisodium Salt. Offered by: Chemat Brand. Available pack sizes: on request.

Heptane-1,1,7-tricarboxylic acid (CAS 855957-40-3) is a chemical compound with the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. IUPAC name: heptane-1,1,7-tricarboxylic acid. InChIKey: LTEIDHMCZYIQLA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O6
Molecular weight232.23 g/mol
IUPAC nameheptane-1,1,7-tricarboxylic acid
InChIKeyLTEIDHMCZYIQLA-UHFFFAOYSA-N
SMILESC(CCCC(=O)O)CCC(C(=O)O)C(=O)O

Computed by PubChem (NCBI)