CAS 62934-90-1 is the registry number for 2,2-Dimethyl-1,3,5-pentanetricarboxylic Acid. Offered by: TRC. Available pack sizes: 2,5g.
2,2-dimethylpentane-1,3,5-tricarboxylic acid (CAS 62934-90-1) is a chemical compound with the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. IUPAC name: 2,2-dimethylpentane-1,3,5-tricarboxylic acid. InChIKey: SRXBEKYXSVLAPC-UHFFFAOYSA-N.
| Molecular formula | C10H16O6 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 2,2-dimethylpentane-1,3,5-tricarboxylic acid |
| InChIKey | SRXBEKYXSVLAPC-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)C(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)