CAS 151767-35-0 appears in our catalog under these names: Methyl-2-deoxy-D-ribofuranoside diacetate, 95%, 3-Acetoxy-5-methoxy-tetrahydrofuran-2-yl Methyl Ester Acetic Acid, Methyl 3,5-di-O-acetyl-2-deoxy-D-ribofuranoside. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 50mg, 25mg, 100mg.
[(2R,3S)-3-acetyloxy-5-methoxyoxolan-2-yl]methyl acetate (CAS 151767-35-0) is a chemical compound with the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. IUPAC name: [(2R,3S)-3-acetyloxy-5-methoxyoxolan-2-yl]methyl acetate. InChIKey: MBNZXGFEXJLTGC-QIIDTADFSA-N.
| Molecular formula | C10H16O6 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | [(2R,3S)-3-acetyloxy-5-methoxyoxolan-2-yl]methyl acetate |
| InChIKey | MBNZXGFEXJLTGC-QIIDTADFSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](CC(O1)OC)OC(=O)C |
Computed by PubChem (NCBI)