Products 65844-74-8

CAS 65844-74-8 is the registry number for Trimethyl 2-methylpropane-1,1,3-tricarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Trimethyl 2-methylpropane-1,1,3-tricarboxylate (CAS 65844-74-8) is a chemical compound with the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. IUPAC name: trimethyl 2-methylpropane-1,1,3-tricarboxylate. InChIKey: RXJAOXZWWQADKO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O6
Molecular weight232.23 g/mol
IUPAC nametrimethyl 2-methylpropane-1,1,3-tricarboxylate
InChIKeyRXJAOXZWWQADKO-UHFFFAOYSA-N
SMILESCC(CC(=O)OC)C(C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)