Products 1119391-68-2
CAS 1119391-68-2 is the registry number for 11-methylbenzo(b)indeno(3,2-e)1H-1,4-diazepin-12-one. Offered by: Biosynth. Available pack sizes: 250mg.
11-methyl-10H-indeno[2,1-c][1,5]benzodiazepin-12-one (CAS 1119391-68-2) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 11-methyl-10H-indeno[2,1-c][1,5]benzodiazepin-12-one. InChIKey: WCQFBSQQGRLAGT-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 11-methyl-10H-indeno[2,1-c][1,5]benzodiazepin-12-one |
| InChIKey | WCQFBSQQGRLAGT-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC3=CC=CC=C3N1)C4=CC=CC=C4C2=O |
Computed by PubChem (NCBI)