CAS 1119391-81-9 is the registry number for (4,4-dimethyl-2,6-dioxocyclohexyl)thiocarboxamidine. Offered by: Biosynth. Available pack sizes: 250mg.
(4,4-dimethyl-2,6-dioxocyclohexyl) carbamimidothioate (CAS 1119391-81-9) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: (4,4-dimethyl-2,6-dioxocyclohexyl) carbamimidothioate. InChIKey: CPEBLKYJQDDZOR-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | (4,4-dimethyl-2,6-dioxocyclohexyl) carbamimidothioate |
| InChIKey | CPEBLKYJQDDZOR-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C(C(=O)C1)SC(=N)N)C |
Computed by PubChem (NCBI)