Products 1119454-13-5
CAS 1119454-13-5 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethoxy)benzoic acid, 95%, 2,4-Difluoro-3-(trifluoromethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
2,4-difluoro-3-(trifluoromethoxy)benzoic acid (CAS 1119454-13-5) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethoxy)benzoic acid. InChIKey: XIGZCSAWUPZMGI-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethoxy)benzoic acid |
| InChIKey | XIGZCSAWUPZMGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)OC(F)(F)F)F |
Computed by PubChem (NCBI)