Products 1309597-49-6

CAS 1309597-49-6 is the registry number for 2,3-Difluoro-4-(trifluoromethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2,3-difluoro-4-(trifluoromethoxy)benzoic acid (CAS 1309597-49-6) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethoxy)benzoic acid. InChIKey: XZRSTEMHRVHLGP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F5O3
Molecular weight242.10 g/mol
IUPAC name2,3-difluoro-4-(trifluoromethoxy)benzoic acid
InChIKeyXZRSTEMHRVHLGP-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)F)F)OC(F)(F)F

Computed by PubChem (NCBI)