CAS 1360438-69-2 is the registry number for 3,5-Difluoro-4-(trifluoromethoxy)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-4-(trifluoromethoxy)benzoic acid (CAS 1360438-69-2) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethoxy)benzoic acid. InChIKey: HFEYMZZPTKZDNA-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 3,5-difluoro-4-(trifluoromethoxy)benzoic acid |
| InChIKey | HFEYMZZPTKZDNA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OC(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)