Products 1360438-69-2

CAS 1360438-69-2 is the registry number for 3,5-Difluoro-4-(trifluoromethoxy)benzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

3,5-difluoro-4-(trifluoromethoxy)benzoic acid (CAS 1360438-69-2) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 3,5-difluoro-4-(trifluoromethoxy)benzoic acid. InChIKey: HFEYMZZPTKZDNA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3F5O3
Molecular weight242.10 g/mol
IUPAC name3,5-difluoro-4-(trifluoromethoxy)benzoic acid
InChIKeyHFEYMZZPTKZDNA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)OC(F)(F)F)F)C(=O)O

Computed by PubChem (NCBI)