Products 128426-86-8
CAS 128426-86-8 is the registry number for 3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g.
3-(difluoromethoxy)-2,4,5-trifluorobenzoic acid (CAS 128426-86-8) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 3-(difluoromethoxy)-2,4,5-trifluorobenzoic acid. InChIKey: XKNIFQLRUBLKKI-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 3-(difluoromethoxy)-2,4,5-trifluorobenzoic acid |
| InChIKey | XKNIFQLRUBLKKI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)OC(F)F)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Difluoromethoxy)-2,4,5-trifluorobenzoic acid, 3-difluoromethoxy-2,4,5-trifluorobenzoic acid, 3-(difluoromethoxy)-2,4,5-trifluoro-benzoic acid, Benzoic acid, 3-(difluoromethoxy)-2,4,5-trifluoro-, 2,4,5-trifluoro-3-difluoromethoxybenzoic acid, 3-difluoromethoxy-2,4.5-trifluorobenzoic acid