Products 652-24-4
CAS 652-24-4 is the registry number for Pentafluoromandelic acid, 99%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g.
2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)acetic acid (CAS 652-24-4) is a chemical compound with the molecular formula C8H3F5O3 and a molecular weight of 242.10 g/mol. IUPAC name: 2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)acetic acid. InChIKey: GGQAKKRNFCXRFB-UHFFFAOYSA-N.
| Molecular formula | C8H3F5O3 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-hydroxy-2-(2,3,4,5,6-pentafluorophenyl)acetic acid |
| InChIKey | GGQAKKRNFCXRFB-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(C(=O)O)O |
Computed by PubChem (NCBI)