CAS 1119577-01-3 is the registry number for 2-Chloro-4-methyl-5,8-dihydropteridine-6,7-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-4-methyl-5,8-dihydropteridine-6,7-dione (CAS 1119577-01-3) is a chemical compound with the molecular formula C7H5ClN4O2 and a molecular weight of 212.59 g/mol. IUPAC name: 2-chloro-4-methyl-5,8-dihydropteridine-6,7-dione. InChIKey: IMWDIUVCNDPXIY-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O2 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 2-chloro-4-methyl-5,8-dihydropteridine-6,7-dione |
| InChIKey | IMWDIUVCNDPXIY-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=N1)Cl)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)