CAS 2639294-46-3 is the registry number for Methyl 4-chloro-1H-pyrazolo[3,4-d]pyrimidine-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylate (CAS 2639294-46-3) is a chemical compound with the molecular formula C7H5ClN4O2 and a molecular weight of 212.59 g/mol. IUPAC name: methyl 4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylate. InChIKey: KCCPMIFCERQLAB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O2 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | methyl 4-chloro-2H-pyrazolo[3,4-d]pyrimidine-3-carboxylate |
| InChIKey | KCCPMIFCERQLAB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=NN1)N=CN=C2Cl |
Computed by PubChem (NCBI)