Products 2518416-99-2
CAS 2518416-99-2 is the registry number for 6-Chloromethyl Lumazine. Offered by: TRC. Available pack sizes: 1g.
6-(chloromethyl)-1H-pteridine-2,4-dione (CAS 2518416-99-2) is a chemical compound with the molecular formula C7H5ClN4O2 and a molecular weight of 212.59 g/mol. IUPAC name: 6-(chloromethyl)-1H-pteridine-2,4-dione. InChIKey: RGUMQPOWAPHHDK-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O2 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 6-(chloromethyl)-1H-pteridine-2,4-dione |
| InChIKey | RGUMQPOWAPHHDK-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)NC(=O)NC2=O)CCl |
Computed by PubChem (NCBI)