CAS 2256052-28-3 is the registry number for Methyl 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate (CAS 2256052-28-3) is a chemical compound with the molecular formula C7H5ClN4O2 and a molecular weight of 212.59 g/mol. IUPAC name: methyl 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate. InChIKey: IEYBFQYOKAWWAB-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O2 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | methyl 6-chloro-[1,2,4]triazolo[4,3-a]pyrazine-3-carboxylate |
| InChIKey | IEYBFQYOKAWWAB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN=C2N1C=C(N=C2)Cl |
Computed by PubChem (NCBI)