CAS 2718971-76-5 is the registry number for 4-Chloro-5-methyl-5,8-dihydropteridine-6,7-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-methyl-8H-pteridine-6,7-dione (CAS 2718971-76-5) is a chemical compound with the molecular formula C7H5ClN4O2 and a molecular weight of 212.59 g/mol. IUPAC name: 4-chloro-5-methyl-8H-pteridine-6,7-dione. InChIKey: DEOIQTVEBXPTKQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O2 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 4-chloro-5-methyl-8H-pteridine-6,7-dione |
| InChIKey | DEOIQTVEBXPTKQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC(=O)C1=O)N=CN=C2Cl |
Computed by PubChem (NCBI)