CAS 111992-61-1 appears in our catalog under these names: 2-(3-Bromo-2,2-dimethylpropyl)isoindoline-1,3-dione, 95%, 2–(3–Bromo–2,2–dimethylpropyl)isoindoline–1,3–dione, 2-(3-Bromo-2,2-dimethylpropyl)isoindoline-1,3-dione, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-(3-bromo-2,2-dimethylpropyl)isoindole-1,3-dione (CAS 111992-61-1) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: 2-(3-bromo-2,2-dimethylpropyl)isoindole-1,3-dione. InChIKey: LQAHBCLEIHEEPN-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | 2-(3-bromo-2,2-dimethylpropyl)isoindole-1,3-dione |
| InChIKey | LQAHBCLEIHEEPN-UHFFFAOYSA-N |
| SMILES | CC(C)(CN1C(=O)C2=CC=CC=C2C1=O)CBr |
Computed by PubChem (NCBI)