Products 1346575-60-7

CAS 1346575-60-7 is the registry number for 6-Bromo-1-isopropyl-3-methyl-1h-indole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

6-bromo-3-methyl-1-propan-2-ylindole-4-carboxylic acid (CAS 1346575-60-7) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: 6-bromo-3-methyl-1-propan-2-ylindole-4-carboxylic acid. InChIKey: HNMDJRSGZVKODO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BrNO2
Molecular weight296.16 g/mol
IUPAC name6-bromo-3-methyl-1-propan-2-ylindole-4-carboxylic acid
InChIKeyHNMDJRSGZVKODO-UHFFFAOYSA-N
SMILESCC1=CN(C2=CC(=CC(=C12)C(=O)O)Br)C(C)C

Computed by PubChem (NCBI)