CAS 868561-17-5 is the registry number for 1-BOC-7-bromoindole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 7-bromoindole-1-carboxylate (CAS 868561-17-5) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: tert-butyl 7-bromoindole-1-carboxylate. InChIKey: QKTLZTNNVUGEOY-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | tert-butyl 7-bromoindole-1-carboxylate |
| InChIKey | QKTLZTNNVUGEOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)