Products 72016-68-3
CAS 72016-68-3 appears in our catalog under these names: Ethyl 2-(5-bromo-2-methyl-1H-indol-3-yl)acetate, 97%, Ethyl 2–(5–bromo–2–methyl–1H–indol–3–yl)acetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 250mg.
Ethyl 2-(5-bromo-2-methyl-1H-indol-3-yl)acetate (CAS 72016-68-3) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: ethyl 2-(5-bromo-2-methyl-1H-indol-3-yl)acetate. InChIKey: GNAIWTYKMSIQQR-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | ethyl 2-(5-bromo-2-methyl-1H-indol-3-yl)acetate |
| InChIKey | GNAIWTYKMSIQQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(NC2=C1C=C(C=C2)Br)C |
Computed by PubChem (NCBI)