CAS 690632-08-7 is the registry number for 6-bromo-3H-spiro[1-benzopyran-2,4'-piperidine]-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
6-bromospiro[3H-chromene-2,4'-piperidine]-4-one (CAS 690632-08-7) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: 6-bromospiro[3H-chromene-2,4'-piperidine]-4-one. InChIKey: HTOKNOIQHUEHNB-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | 6-bromospiro[3H-chromene-2,4'-piperidine]-4-one |
| InChIKey | HTOKNOIQHUEHNB-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)