Products 112018-26-5
CAS 112018-26-5 appears in our catalog under these names: (R)–Diethyl 2–aminosuccinate hydrochloride, H-D-Asp(OEt)-OEt·HCl 95%, (R)-Diethyl 2-aminosuccinate hydrochloride, 95%, 95%, (R)-Diethyl 2-aminosuccinate hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 500g.
Diethyl (2R)-2-aminobutanedioate;hydrochloride (CAS 112018-26-5) is a chemical compound with the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. IUPAC name: diethyl (2R)-2-aminobutanedioate;hydrochloride. InChIKey: AJOXZAAREAYBQR-FYZOBXCZSA-N.
| Molecular formula | C8H16ClNO4 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | diethyl (2R)-2-aminobutanedioate;hydrochloride |
| InChIKey | AJOXZAAREAYBQR-FYZOBXCZSA-N |
| SMILES | CCOC(=O)C[C@H](C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Diethyl D-aspartate--hydrogen chloride (1/1), (R)-Diethyl 2-aminosuccinate hydrochloride, D-Aspartic acid diethyl ester hydrochloride, (R)-diethyl 2-aminosuccinate HCl, diethyl (2R)-2-aminobutanedioate;hydrochloride, Diethyl D-aspartate hydrochloride, (R)-Diethyl2-aminosuccinatehydrochloride, (r)-aspartic acid diethyl ester hydrochloride, H-D-Asp(OEt)-OEt.HCl, Diethyl (R)-2-Aminosuccinate Hydrochloride