CAS 16115-68-7 appears in our catalog under these names: H–Asp(OEt)–OEt·HCl, L-Aspartic acid diethyl ester hydrochloride, 98% , Diethyl L-Aspartate Hydrochloride, >98.0%(HPLC)(T), H-Asp(OEt)-OEt·HCl 95%, H-Asp(Oet)-OEt.HCl, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 100g, 10g, 500g, 1000g, 1kg, 100 g.
Diethyl (2S)-2-aminobutanedioate;hydrochloride (CAS 16115-68-7) is a chemical compound with the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. IUPAC name: diethyl (2S)-2-aminobutanedioate;hydrochloride. InChIKey: AJOXZAAREAYBQR-RGMNGODLSA-N.
| Molecular formula | C8H16ClNO4 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | diethyl (2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | AJOXZAAREAYBQR-RGMNGODLSA-N |
| SMILES | CCOC(=O)C[C@@H](C(=O)OCC)N.Cl |
Computed by PubChem (NCBI)