CAS 2425618-87-5 is the registry number for 2-(2-Carboxyacetoxy)-N,N,N-trimethylethan-1-aminium chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-carboxyacetyl)oxyethyl-trimethylazanium chloride (CAS 2425618-87-5) is a chemical compound with the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. IUPAC name: 2-(2-carboxyacetyl)oxyethyl-trimethylazanium chloride. InChIKey: GCHYFEBTLWFDTQ-UHFFFAOYSA-N.
| Molecular formula | C8H16ClNO4 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | 2-(2-carboxyacetyl)oxyethyl-trimethylazanium chloride |
| InChIKey | GCHYFEBTLWFDTQ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCOC(=O)CC(=O)O.[Cl-] |
Computed by PubChem (NCBI)