CAS 176164-02-6 appears in our catalog under these names: H-L-Asp-otbu hydrochloride, 95%, H-L-Asp-OtBu*HCl. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 25g, 5g.
(3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;hydrochloride (CAS 176164-02-6) is a chemical compound with the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. IUPAC name: (3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;hydrochloride. InChIKey: UIGULSHPWYAWSA-JEDNCBNOSA-N.
| Molecular formula | C8H16ClNO4 |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | (3S)-3-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid;hydrochloride |
| InChIKey | UIGULSHPWYAWSA-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)