Products 2407068-41-9

CAS 2407068-41-9 is the registry number for 5-[(2-carboxyethyl)amino]pentanoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

5-(2-carboxyethylamino)pentanoic acid;hydrochloride (CAS 2407068-41-9) is a chemical compound with the molecular formula C8H16ClNO4 and a molecular weight of 225.67 g/mol. IUPAC name: 5-(2-carboxyethylamino)pentanoic acid;hydrochloride. InChIKey: TYSHEQHFGWWXRU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO4
Molecular weight225.67 g/mol
IUPAC name5-(2-carboxyethylamino)pentanoic acid;hydrochloride
InChIKeyTYSHEQHFGWWXRU-UHFFFAOYSA-N
SMILESC(CCNCCC(=O)O)CC(=O)O.Cl

Computed by PubChem (NCBI)