CAS 112091-17-5 appears in our catalog under these names: (S)-6-Chloronicotine, >95% (HPLC), (S)-2-Chloro-5-(1-methylpyrrolidin-2-yl)pyridine, 97%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 1g.
2-chloro-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine (CAS 112091-17-5) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-chloro-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine. InChIKey: SVVOLGNZRGLPIU-VIFPVBQESA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-chloro-5-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| InChIKey | SVVOLGNZRGLPIU-VIFPVBQESA-N |
| SMILES | CN1CCC[C@H]1C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)