CAS 112243-70-6 is the registry number for N-((S)-1-Carbethoxybutyl)-(S)-alanine Benzyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate (CAS 112243-70-6) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate. InChIKey: IRRWRQHUODGTBM-ZFWWWQNUSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | ethyl (2S)-2-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]pentanoate |
| InChIKey | IRRWRQHUODGTBM-ZFWWWQNUSA-N |
| SMILES | CCC[C@@H](C(=O)OCC)N[C@@H](C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)