CAS 1123219-12-4 is the registry number for DPP-4-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-(1,3-benzodioxol-5-ylmethyl)-7H-purin-6-amine (CAS 1123219-12-4) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: 8-(1,3-benzodioxol-5-ylmethyl)-7H-purin-6-amine. InChIKey: VFDGORRIVDEKML-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 8-(1,3-benzodioxol-5-ylmethyl)-7H-purin-6-amine |
| InChIKey | VFDGORRIVDEKML-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CC3=NC4=NC=NC(=C4N3)N |
Computed by PubChem (NCBI)