CAS 361986-58-5 is the registry number for 3-[(1-Methyl-1h-pyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid (CAS 361986-58-5) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: 3-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid. InChIKey: OCHDRKQTIRJRGE-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | 3-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]benzoic acid |
| InChIKey | OCHDRKQTIRJRGE-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=NC(=C2C=N1)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)