CAS 122062-65-1 is the registry number for N-((1H-Benzo[d][1,2,3]triazol-1-yl)methyl)-3-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
N-(benzotriazol-1-ylmethyl)-3-nitroaniline (CAS 122062-65-1) is a chemical compound with the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. IUPAC name: N-(benzotriazol-1-ylmethyl)-3-nitroaniline. InChIKey: FSJMZFUALNDQSF-UHFFFAOYSA-N.
| Molecular formula | C13H11N5O2 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | N-(benzotriazol-1-ylmethyl)-3-nitroaniline |
| InChIKey | FSJMZFUALNDQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CNC3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)